BD4889541
3-Bromofuran-2-carbaldehyde , 96% , 14757-78-9
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB132.00 | In Stock |
|
| 1g | RMB204.80 | In Stock |
|
| 5g | RMB848.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 219.6±20.0℃ (760 Torr) |
| Density | 1.748±0.06 g/cm3 (20 ºC 760 Torr) |
| Flash point: | 86.6±21.8℃ |
| storage temp. | Inert atmosphere,Store in freezer, under -20°C |
| form | powder to lump to clear liquid |
| color | White or Colorless to Yellow |
| InChI | InChI=1S/C5H3BrO2/c6-4-1-2-8-5(4)3-7/h1-3H |
| InChIKey | KSAVZSUPQGDMRC-UHFFFAOYSA-N |
| SMILES | O1C=CC(Br)=C1C=O |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H319 |
| Precautionary statements | P305+P351+P338 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 22 |
| WGK Germany | WGK 3 |
| Hazard Note | Irritant |
| HS Code | 2932190090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 |






