BD4938041
2,4,6-Trimethoxybenzylaminehydrochloride , 98% , 146548-59-6
CAS NO.:146548-59-6
Empirical Formula: C10H16ClNO3
Molecular Weight: 233.69
MDL number: MFCD00012855
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB156.00 | In Stock |
|
| 250mg | RMB280.00 | In Stock |
|
| 1g | RMB700.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 204-207 °C(lit.) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | Powder |
| color | White to off-white |
| InChI | 1S/C10H15NO3.ClH/c1-12-7-4-9(13-2)8(6-11)10(5-7)14-3;/h4-5H,6,11H2,1-3H3;1H |
| InChIKey | BLFRMOOGAICNSZ-UHFFFAOYSA-N |
| SMILES | Cl.COc1cc(OC)c(CN)c(OC)c1 |
| CAS DataBase Reference | 146548-59-6(CAS DataBase Reference) |
Description and Uses
2,4,6-Trimethoxybenzylamine hydrochloride was used in synthesis of 3-(aminomethyl)isoquinoline.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







