BD4962441
trans-1,2-Dithiane-4,5-diol , 95% , 14193-38-5
Synonym(s):
trans-1,2-Dithiane-4,5-diol;Oxidized DTT
CAS NO.：14193-38-5
Empirical Formula: C4H8O2S2
Molecular Weight: 152.24
MDL number: MFCD00006661
EINECS: 238-047-6
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB156.80 | In Stock |
|
| 1g | RMB387.20 | In Stock |
|
| 5g | RMB1349.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 130-132 °C(lit.) |
| Boiling point: | 284.9±40.0 °C(Predicted) |
| Density | 1.531±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| pka | 13.28±0.40(Predicted) |
| form | powder |
| Appearance | White to off-white Solid |
| InChI | InChI=1S/C4H8O2S2/c5-3-1-7-8-2-4(3)6/h3-6H,1-2H2/t3-,4-/m1/s1 |
| InChIKey | YPGMOWHXEQDBBV-QWWZWVQMSA-N |
| SMILES | O[C@@H]1CSSC[C@H]1O |
Description and Uses
trans-4,5-Dihydroxy-1,2-dithiane is used in preparation of 1,2-Dithiolane compounds useful in neuroprotection, autoimmune and cancer diseases and conditions.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
