BD4991841
N,N-Diethylsalicylamide , 97% , 19311-91-2
CAS NO.:19311-91-2
Empirical Formula: C11H15NO2
Molecular Weight: 193.24
MDL number: MFCD00010816
EINECS: 242-955-8
| Pack Size | Price | Stock | Quantity |
| 1g | RMB79.20 | In Stock |
|
| 5g | RMB230.40 | In Stock |
|
| 10g | RMB444.00 | In Stock |
|
| 25g | RMB1004.00 | In Stock |
|
| 100g | RMB2964.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 93-97 °C (lit.) |
| Boiling point: | 340℃ |
| Density | 1.096 |
| refractive index | 1.5080 (estimate) |
| Flash point: | 159℃ |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 8.73±0.30(Predicted) |
| form | Crystalline Powder |
| color | White to tan |
| InChI | InChI=1S/C11H15NO2/c1-3-12(4-2)11(14)9-7-5-6-8-10(9)13/h5-8,13H,3-4H2,1-2H3 |
| InChIKey | ZVYXEXAXXWINEH-UHFFFAOYSA-N |
| SMILES | C(N(CC)CC)(=O)C1=CC=CC=C1O |
Description and Uses
N,N-Diethylsalicylamide is an important raw material and intermediate used in organic synthesis, pharmaceuticals, agrochemicals and dyestuff fields.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312+P330-P501 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| RTECS | VN7320000 |
| HS Code | 2924297099 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |






