BD5002041
Cyclohexyl(piperazin-1-yl)methanone , 96% , 27561-62-2
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB68.00 | In Stock |
|
| 1g | RMB175.20 | In Stock |
|
| 5g | RMB536.00 | In Stock |
|
| 25g | RMB1768.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 84-89 °C (lit.) |
| Boiling point: | 350.5±35.0 °C(Predicted) |
| Density | 1.047±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | soluble in Methanol |
| pka | 8.47±0.10(Predicted) |
| form | Solid |
| color | White to brown |
| InChI | InChI=1S/C11H20N2O/c14-11(10-4-2-1-3-5-10)13-8-6-12-7-9-13/h10,12H,1-9H2 |
| InChIKey | ZSZROXCAFYZNHE-UHFFFAOYSA-N |
| SMILES | C(C1CCCCC1)(N1CCNCC1)=O |
Description and Uses
1-(Cyclohexylcarbonyl)piperazine is mainly used as a pharmaceutical intermediate.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H315-H318-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 37/38-41 |
| Safety Statements | 26-36/37/39 |
| WGK Germany | 3 |
| HS Code | 2933599590 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |






