BD5035541
Ethylcis-3-Bromoacrylate , 98% , 31930-34-4
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB225.60 | In Stock |
|
| 250mg | RMB338.40 | In Stock |
|
| 1g | RMB676.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 75 °C (12 mmHg) |
| Density | 1.48 g/mL at 20 °C |
| refractive index | n |
| Flash point: | 59.00°C |
| storage temp. | 2-8°C |
| solubility | soluble in Methanol |
| form | clear liquid |
| color | Colorless to Almost colorless |
| BRN | 1902817 |
| InChI | InChI=1S/C5H7BrO2/c1-2-8-5(7)3-4-6/h3-4H,2H2,1H3/b4-3- |
| InChIKey | UJTJVQIYRQALIK-ARJAWSKDSA-N |
| SMILES | C(OCC)(=O)/C=C\Br |
Description and Uses
Ethyl cis-3-bromoacrylate was used in the preparation of ethyl 2-amino-9-(2-deoxy-β-D-erythropentofuranosyl)-6,9-dihydro-6-oxo-1H-purine-1-acrylate. It was used in the synthesis of 3-(2-deoxy-β-D-erythro-pentofuranosyl)-3,4-dihydropyrimido[1,2-a]purine-6,10-dione. It was employed as building block for the stereoselective preparation of cis-2-enoates.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-52/53-22 |
| Safety Statements | 26-36-61 |
| RIDADR | UN 3082 9/PG 3 |
| WGK Germany | 3 |
| F | 19 |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29161900 |
