BD5041341
Atorvastatin , 98% , 134523-00-5
CAS NO.:134523-00-5
Empirical Formula: C33H35FN2O5
Molecular Weight: 558.65
MDL number: MFCD03613598
EINECS: 806-698-0
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB128.00 | In Stock |
|
| 250mg | RMB192.00 | In Stock |
|
| 1g | RMB432.00 | In Stock |
|
| 5g | RMB1300.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 176-178°C |
| Boiling point: | 722.2±60.0 °C(Predicted) |
| Density | 1.23±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | DMSO: 100 mg/mL (179.01 mM) |
| form | Solid |
| pka | pKa 4.46(H2O t=30 Iuncontrolled) (Uncertain) |
| color | White to light yellow |
| Major Application | pharmaceutical |
| InChIKey | XUKUURHRXDUEBC-FQWVHLSFNA-N |
| SMILES | C(C1=C(N(CC[C@@H](O)C[C@@H](O)CC(=O)O)C(C2C=CC(F)=CC=2)=C1C1C=CC=CC=1)C(C)C)(=O)NC1C=CC=CC=1 |&1:6,9,r| |
| CAS DataBase Reference | 134523-00-5(CAS DataBase Reference) |
| EPA Substance Registry System | 1H-Pyrrole-1-heptanoic acid, 2-(4-fluorophenyl)-?,?-dihydroxy-5-(1-methylethyl)-3-phenyl-4-[(phenylamino)carbonyl]-, (?R,?R)- (134523-00-5) |
Description and Uses
antihyperlipoproteimic;HMG-CoA reductase inhibition
Safety
| Symbol(GHS) | ![]() ![]() GHS03,GHS07 |
| Signal word | Warning |
| Hazard statements | H272-H315-H319-H335 |
| Precautionary statements | P221-P261-P264b-P271-P280-P302+P352-P304+P340-P305+P351+P338-P312-P362+P364-P370+P378r-P370+P380+P375-P380-P501c |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | WGK 3 |
| HS Code | 35040000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Repr. 2 |
| Hazardous Substances Data | 134523-00-5(Hazardous Substances Data) |







