BD5088441
4-Bromo-3-fluoropyridine , 98% , 2546-52-3
CAS NO.：2546-52-3
Empirical Formula: C5H3BrFN
Molecular Weight: 175.99
MDL number: MFCD04113266
EINECS: 678-655-2
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB136.00 | In Stock |
|
| 1g | RMB352.80 | In Stock |
|
| 5g | RMB572.00 | In Stock |
|
| 25g | RMB2288.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 160-163 °C |
| Density | 1.707±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| pka | 2.22±0.10(Predicted) |
| form | solid |
| color | Pale brown |
| InChI | InChI=1S/C5H3BrFN/c6-4-1-2-8-3-5(4)7/h1-3H |
| InChIKey | QBLOMVIUENUOJY-UHFFFAOYSA-N |
| SMILES | C1=NC=CC(Br)=C1F |
| CAS DataBase Reference | 2546-52-3(CAS DataBase Reference) |
Description and Uses
4-Bromo-3-fluoropyridine is a useful research reagent for organic synthesis and other chemical processes. A fluoronitropyridines derivative with multiple chemical applications.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H319-H335-H302+H312+H332-H315 |
| Precautionary statements | P271-P261-P280 |
| HS Code | 29333999 |
