A6633912
4-Pyridineacetic Acid Hydrochloride , 98% , 6622-91-9
Synonym(s):
4-Pyridineacetic acid hydrochloride
CAS NO.：6622-91-9
Empirical Formula: C7H8ClNO2
Molecular Weight: 173.6
MDL number: MFCD00012827
EINECS: 229-576-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB53.60 | In Stock |
|
| 5G | RMB173.60 | In Stock |
|
| 25G | RMB758.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 141 °C (dec.)(lit.) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | DMSO, Methanol, Water |
| form | Crystalline Powder, Crystals and/or Chunks |
| color | White to cream |
| BRN | 3696648 |
| InChI | InChI=1S/C7H7NO2.ClH/c9-7(10)5-6-1-3-8-4-2-6;/h1-4H,5H2,(H,9,10);1H |
| InChIKey | WKJRYVOTVRPAFN-UHFFFAOYSA-N |
| SMILES | C1(CC(=O)O)C=CN=CC=1.Cl |
| CAS DataBase Reference | 6622-91-9(CAS DataBase Reference) |
Description and Uses
4-Pyridineacetic Acid Hydrochloride is used in the preparation of a highly tumor-selective organometallic ruthenium(II)-Arene complex.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| F | 10 |
| TSCA | T |
| HazardClass | IRRITANT |
| HS Code | 29333990 |
