BD5125841
3-(1,1,1,5,5,5-Hexamethyl-3-((trimethylsilyl)oxy)trisiloxan-3-yl)propylacrylate , 95% , 17096-12-7
| Pack Size | Price | Stock | Quantity |
| 1g | RMB28.80 | In Stock |
|
| 5g | RMB100.00 | In Stock |
|
| 10g | RMB185.60 | In Stock |
|
| 25g | RMB406.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 136-138°C 1mm |
| Density | 0,88 g/cm3 |
| refractive index | 1.4180 |
| Flash point: | >110°C |
| storage temp. | Inert atmosphere,2-8°C |
| Specific Gravity | 0.88 |
| Hydrolytic Sensitivity | 3: reacts with aqueous base |
| InChI | InChI=1S/C15H36O5Si4/c1-11-15(16)17-13-12-14-24(18-21(2,3)4,19-22(5,6)7)20-23(8,9)10/h11H,1,12-14H2,2-10H3 |
| InChIKey | PPBAWVJOPQUAMY-UHFFFAOYSA-N |
| SMILES | C(OCCC[Si](O[Si](C)(C)C)(O[Si](C)(C)C)O[Si](C)(C)C)(=O)C=C |
Description and Uses
(3-Acryloxypropyl)tris(trimethylsiloxy)silane is an acrylate monomer that acts as a silane coupling agent to enhance the performance of polymers and composites. It is particularly suitable for UV-curing and epoxy systems.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H332-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| TSCA | No |
