A7941312
3-(Trimethoxysilyl)propyl Acrylate (stabilized with BHT) , >93.0%(GC) , 4369-14-6
Synonym(s):
(3-Acryloyloxypropyl)trimethoxysilane
CAS NO.:4369-14-6
Empirical Formula: C9H18O5Si
Molecular Weight: 234.32
MDL number: MFCD00054803
EINECS: 419-560-6
| Pack Size | Price | Stock | Quantity |
| 5G | RMB150.40 | In Stock |
|
| 25G | RMB493.60 | In Stock |
|
| 100G | RMB1200.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 68 °C0.4 mm Hg(lit.) |
| Density | 1.055 g/mL at 25 °C(lit.) |
| vapor pressure | 20.5Pa at 25℃ |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | Miscible with organic solvents. |
| form | Liquid |
| Specific Gravity | 1.0 |
| color | Clear colorless |
| Water Solubility | 5.8-4300mg/L at 20℃ |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| Sensitive | Moisture Sensitive |
| BRN | 2046320 |
| Cosmetics Ingredients Functions | SOLVENT |
| InChI | 1S/C9H18O5Si/c1-5-9(10)14-7-6-8-15(11-2,12-3)13-4/h5H,1,6-8H2,2-4H3 |
| InChIKey | KBQVDAIIQCXKPI-UHFFFAOYSA-N |
| SMILES | CO[Si](CCCOC(=O)C=C)(OC)OC |
| LogP | 1.6-2.18 at 20-23℃ |
| CAS DataBase Reference | 4369-14-6(CAS DataBase Reference) |
| EPA Substance Registry System | 2-Propenoic acid, 3-(trimethoxysilyl)propyl ester (4369-14-6) |
Description and Uses
3-(Acryloyloxy)propyltrimethoxysilane is used to enhance the thermal conductivity of silicone rubber filled with hybrid fillers. It is involved in the synthesis of vinyl and acryalte modified silica nanoparticles by using vinyltrimethoxysilane. Further, it is used as a silane coupling agent involved in the modification of fluorescein isothiocyanate-mesoporous silica nanoparticles with carbon-carbon double bonds.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H314-H317-H332-H412 |
| Precautionary statements | P261-P273-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi,C |
| Risk Statements | 37/38-41-52/53-43-37-34-20 |
| Safety Statements | 26-39-61-45-36/37/39 |
| RIDADR | UN1760 |
| WGK Germany | 3 |
| RTECS | UD3810000 |
| F | 10-21 |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29319090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Acute Tox. 4 Inhalation Aquatic Chronic 3 Eye Dam. 1 Skin Corr. 1B Skin Sens. 1 |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |








![3-[Diethoxy(methyl)silyl]propyl Methacrylate](https://img.chemicalbook.com/CAS/GIF/65100-04-1.gif)