BD7781731
3-(Trimethoxysilyl)propyl acetate , 95% , 59004-18-1
CAS NO.:59004-18-1
Empirical Formula: C8H18O5Si
Molecular Weight: 222.31
MDL number: MFCD00039834
EINECS: 261-552-8
| Pack Size | Price | Stock | Quantity |
| 5g | RMB71.20 | In Stock |
|
| 25g | RMB238.40 | In Stock |
|
| 100g | RMB792.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | <0°C |
| Boiling point: | 92 °C |
| Density | 1.062 |
| refractive index | 1.4146 |
| Flash point: | 93°C |
| storage temp. | 2-8°C |
| Specific Gravity | 1.062 |
| Appearance | Colorless to off-white Liquid |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| InChI | InChI=1S/C8H18O5Si/c1-8(9)13-6-5-7-14(10-2,11-3)12-4/h5-7H2,1-4H3 |
| InChIKey | FZTPAOAMKBXNSH-UHFFFAOYSA-N |
| SMILES | C(OC(=O)C)CC[Si](OC)(OC)OC |
Description and Uses
3-(trimethoxysilyl)propyl acetate can be used as an intermediate in the manufacture of lubricants, resins, ceramics and carbon fibre composites, amongst other materials.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| TSCA | No |







![3-[Diethoxy(methyl)silyl]propyl Methacrylate](https://img.chemicalbook.com/CAS/GIF/65100-04-1.gif)