BD8974355
3-(Triisopropoxysilyl)propylmethacrylate , 97% , 80750-05-6
CAS NO.:80750-05-6
Empirical Formula: C16H32O5Si
Molecular Weight: 332.51
MDL number: MFCD08275516
EINECS: 279-538-5
| Pack Size | Price | Stock | Quantity |
| 1g | RMB32.80 | In Stock |
|
| 5g | RMB114.40 | In Stock |
|
| 25g | RMB387.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 348.7±25.0 °C(Predicted) |
| Density | 0,942 g/cm3 |
| refractive index | 1.4234 |
| Flash point: | >60°C (>140°F) |
| storage temp. | below 5° C |
| Specific Gravity | 0.942 |
| Appearance | Colorless to light yellow Liquid |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| InChI | InChI=1S/C16H32O5Si/c1-12(2)16(17)18-10-9-11-22(19-13(3)4,20-14(5)6)21-15(7)8/h13-15H,1,9-11H2,2-8H3 |
| InChIKey | CHPNMYQJQQGAJS-UHFFFAOYSA-N |
| SMILES | C(OCCC[Si](OC(C)C)(OC(C)C)OC(C)C)(=O)C(C)=C |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| TSCA | TSCA listed |







![3-[Diethoxy(methyl)silyl]propyl Methacrylate](https://img.chemicalbook.com/CAS/GIF/65100-04-1.gif)