BD5126141
Boc-Ala-Ala-OH , 97% , 27317-69-7
CAS NO.:27317-69-7
Empirical Formula: C11H20N2O5
Molecular Weight: 260.29
MDL number: MFCD00038564
EINECS: 421-060-8
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB35.20 | In Stock |
|
| 1g | RMB86.40 | In Stock |
|
| 5g | RMB426.40 | In Stock |
|
| 10g | RMB785.60 | In Stock |
|
| 25g | RMB1826.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 132-133 °C |
| Boiling point: | 483.5±30.0 °C(Predicted) |
| Density | 1.163±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 3.52±0.10(Predicted) |
| color | White to Off-White |
| Stability: | Hygroscopic |
| InChI | 1S/C11H20N2O5/c1-6(8(14)12-7(2)9(15)16)13-10(17)18-11(3,4)5/h6-7H,1-5H3,(H,12,14)(H,13,17)(H,15,16)/t6-,7-/m0/s1 |
| InChIKey | BZNDDHWTEVCBAD-BQBZGAKWSA-N |
| SMILES | C[C@H](NC(=O)[C@H](C)NC(=O)OC(C)(C)C)C(O)=O |
Description and Uses
N-Phthalyl-alanine is used in the preparation of endothiopeptide inhibitors of HIV-1 Protease.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| WGK Germany | WGK 3 |
| Storage Class | 11 - Combustible Solids |






