BD5159641
(S)-3-(4-(Allyloxy)phenyl)-2-((tert-butoxycarbonyl)amino)propanoicacid , 95% , 127132-38-1
Synonym(s):
Boc-O-allyl-L -tyrosine
| Pack Size | Price | Stock | Quantity |
| 1g | RMB169.60 | In Stock |
|
| 5g | RMB593.60 | In Stock |
|
| 25g | RMB2076.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 490.4±45.0 °C(Predicted) |
| Density | 1.144±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| pka | 2.99±0.10(Predicted) |
| form | powder |
| Appearance | White to off-white Solid |
| BRN | 3624582 |
| Major Application | peptide synthesis |
| InChI | 1S/C17H23NO5/c1-5-10-22-13-8-6-12(7-9-13)11-14(15(19)20)18-16(21)23-17(2,3)4/h5-9,14H,1,10-11H2,2-4H3,(H,18,21)(H,19,20)/t14-/m0/s1 |
| InChIKey | YIRRNENSHUFZBH-AWEZNQCLSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](Cc1ccc(OCC=C)cc1)C(O)=O |
Description and Uses
Due to gem-dimethyl substituent effect, Boc-Tyr(Allyl)-OH is found to be resistant to Claisen rearrangement in water.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| WGK Germany | 3 |
| F | 10-21 |
| Storage Class | 11 - Combustible Solids |
