BD5199453
4-Methoxyphenylhydrazinehydrochloride , 98% , 19501-58-7
CAS NO.：19501-58-7
Empirical Formula: C7H11ClN2O
Molecular Weight: 174.63
MDL number: MFCD00012945
EINECS: 243-115-3
| Pack Size | Price | Stock | Quantity |
| 5g | RMB138.40 | In Stock |
|
| 25g | RMB503.20 | In Stock |
|
| 100g | RMB1283.20 | In Stock |
|
| 500g | RMB4508.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 160-162 °C (dec.)(lit.) |
| storage temp. | Keep Cold |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Powder, Crystals and/or Chunks |
| color | Slightly pink to gray to purple |
| Water Solubility | soluble |
| BRN | 3566583 |
| Stability: | Light Sensitive |
| InChI | InChI=1S/C7H10N2O.ClH/c1-10-7-4-2-6(9-8)3-5-7;/h2-5,9H,8H2,1H3;1H |
| InChIKey | FQHCPFMTXFJZJS-UHFFFAOYSA-N |
| SMILES | C1(NN)=CC=C(OC)C=C1.Cl |
| CAS DataBase Reference | 19501-58-7(CAS DataBase Reference) |
Description and Uses
4-Methoxyphenylhydrazine hydrochloride is a kind of midbody that is mainly used for producing phenylhydrazine, and can also be used to make other Chemicals. The reparation technology of 4-Methoxyphenylhydrazine hydrochloride comprises aniline diazonium and benzene diazonium chloride diazo benzene chloride two-step process.
4-Methoxyphenylhydrazine hydrochloride was used in the preparation of 5-cyano-3-(5-methoxy-2-methylindol-3-yl)-1,2,4-thiadiazole.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H317 |
| Precautionary statements | P261-P264-P280-P301+P312-P302+P352+P312-P304+P340+P312 |
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 36/37-36-26 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| Hazard Note | Irritant/Harmful |
| HazardClass | IRRITANT, KEEP COLD |
| PackingGroup | III |
| HS Code | 29280090 |
