PRODUCT Properties
| Melting point: | 326-328°C |
| Boiling point: | 363.28°C (rough estimate) |
| Density | 1.3616 (rough estimate) |
| refractive index | 1.4790 (estimate) |
| storage temp. | 2-8°C |
| solubility | DMSO (Sparingly), Methanol (Slightly, Heated) |
| form | Solid |
| pka | 6.82±0.40(Predicted) |
| color | Yellow to Dark Yellow |
| InChI | 1S/C15H10O7/c16-7-1-2-8-11(5-7)22-15(14(21)12(8)19)6-3-9(17)13(20)10(18)4-6/h1-5,16-18,20-21H |
| InChIKey | SOEDEYVDCDYMMH-UHFFFAOYSA-N |
| SMILES | [o]1c2c([c](c(c1c3cc(c(c(c3)O)O)O)O)=O)ccc(c2)O |
| LogP | 2.550 (est) |
Description and Uses
Robinetin (3,3',4',5',7-Pentahydroxyflavone), a naturally occurring flavonoid with remarkable ‘two color’ intrinsic fluorescence properties, has antifungal, antiviral, antibacterial, antimutagenesis, and antioxidant activity. Robinetin also can inhibit lipid peroxidation and protein glycosylation[1][2][3][4][5].
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P304+P340-P305+P351+P338-P312-P321-P332+P313-P337+P313-P362-P403+P233-P405-P501 |
| Risk Statements | 22 |
| Safety Statements | 22-45 |
| RIDADR | 2811 |
| WGK Germany | WGK 3 |
| Storage Class | 11 - Combustible Solids |
