PRODUCT Properties
| Melting point: | 203-205 °C |
| Boiling point: | 615.8±55.0 °C(Predicted) |
| Density | 1.44±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | DMSO: soluble; Methanol: soluble |
| form | A crystalline solid |
| pka | 6.13±0.40(Predicted) |
| color | Light yellow to yellow |
| InChI | InChI=1S/C19H18O8/c1-23-11-7-9(5-6-10(11)20)17-19(26-4)16(22)14-12(27-17)8-13(24-2)18(25-3)15(14)21/h5-8,20-21H,1-4H3 |
| InChIKey | NBVTYGIYKCPHQN-UHFFFAOYSA-N |
| SMILES | O=C1C(=C(C2C=CC(=C(C=2)OC)O)OC2=CC(=C(C(=C21)O)OC)OC)OC |
| LogP | 3.037 (est) |
Description and Uses
Chrysosplenetin is one of the polymethoxylated flavonoids in Artemisia annua L. (Compositae) and other several Chinese herbs. Chrysosplenetin inhibits P-gp activity and reverses the up-regulated P-gp and MDR1 levels induced by artemisinin (ART). Chrysosplenetin significantly augments the rat plasma level and anti-malarial efficacy of ART, partially due to the uncompetitive inhibition effect of Chrysosplenetin on rat CYP3A[1].
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 |
