BD5640041
5-Phenyl-5,12-dihydroindolo[3,2-a]carbazole , 98% , 1247053-55-9
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB47.20 | In Stock |
|
| 1g | RMB107.20 | In Stock |
|
| 5g | RMB520.00 | In Stock |
|
| 25g | RMB2564.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 170 °C |
| Boiling point: | 598.8±32.0 °C(Predicted) |
| Density | 1.26±0.1 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | powder to crystal |
| pka | 16.87±0.30(Predicted) |
| color | White to Light yellow |
| InChI | InChI=1S/C24H16N2/c1-2-8-16(9-3-1)26-21-13-7-5-11-19(21)23-22(26)15-14-18-17-10-4-6-12-20(17)25-24(18)23/h1-15,25H |
| InChIKey | NIYSSWKVTXONEP-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=CC=C2)C2=C1C1C3=C(N(C4=CC=CC=C4)C=1C=C2)C=CC=C3 |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H319-H315 |
| Precautionary statements | P264-P280-P305+P351+P338-P337+P313P-P264-P280-P302+P352-P321-P332+P313-P362 |
| HS Code | 2933.99.8290 |

![5-Phenyl-5,12-dihydroindolo[3,2-a]carbazole](https://img.chemicalbook.com/CAS/20180808/GIF/1247053-55-9.gif)

![11,12-Dihydro-11-phenylindolo[2,3-<i>a</i>]carbazole](https://img.chemicalbook.com/CAS/GIF/1024598-06-8.gif)
![5,7-Dihydro-7,7-dimethyl-indeno[2,1-b]carbazole](https://img.chemicalbook.com/CAS/GIF/1257220-47-5.gif)
![5,11-Dihydroindolo[3,2-<i>b</i>]carbazole](https://img.chemicalbook.com/CAS/GIF/6336-32-9.gif)
![11,11-Dimethyl-5,11-dihydroindeno[1,2-b]carbazole](https://img.chemicalbook.com/CAS/GIF/1260228-95-2.gif)
![5,11-Diphenyl-5,11-dihydroindolo[3,2-b]carbazole](https://img.chemicalbook.com/CAS/20180702/GIF/58328-30-6.gif)