BD7562731
2-Bromo-1-(3,4-dimethoxyphenyl)ethanone , 97% , 1835-02-5
| Pack Size | Price | Stock | Quantity |
| 1g | RMB31.20 | In Stock |
|
| 5g | RMB109.60 | In Stock |
|
| 10g | RMB212.00 | In Stock |
|
| 25g | RMB505.60 | In Stock |
|
| 100g | RMB1981.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 81-83°C |
| Boiling point: | 326.5±27.0 °C(Predicted) |
| Density | 1.422±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | Dichloromethane, Ether, Methanol |
| form | Solid |
| color | Off-White to Light Grey |
| InChI | InChI=1S/C10H11BrO3/c1-13-9-4-3-7(8(12)6-11)5-10(9)14-2/h3-5H,6H2,1-2H3 |
| InChIKey | NUAIPKMBWNVQIM-UHFFFAOYSA-N |
| SMILES | C(=O)(C1=CC=C(OC)C(OC)=C1)CBr |
| CAS DataBase Reference | 1835-02-5(CAS DataBase Reference) |
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P310-P260-P280 |
| RIDADR | UN1759 |
| HazardClass | IRRITANT |
| HS Code | 2934999090 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
![2-Bromo-1-(3,4-dihydro-2H-benzo[b][1,4]dioxepin-7-yl)ethan-1-one](https://img.chemicalbook.com/CAS/GIF/35970-34-4.gif)
