BD7602731
4,8-Dihydroxyquinoline-2-carboxylic acid , 98% , 59-00-7
Synonym(s):
4,8-Dihydroxyquinaldic acid;4,8-Dihydroxyquinoline-2-carboxylic acid
CAS NO.:59-00-7
Empirical Formula: C10H7NO4
Molecular Weight: 205.17
MDL number: MFCD00006754
EINECS: 200-410-1
| Pack Size | Price | Stock | Quantity |
| 1g | RMB527.20 | In Stock |
|
| 5g | RMB2110.40 | In Stock |
|
| 10g | RMB4158.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 297-298 °C (dec.)(lit.) |
| Boiling point: | 343.83°C (rough estimate) |
| Density | 1.3849 (rough estimate) |
| refractive index | 1.5600 (estimate) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | DMSO (Slightly, Heated), Water (Slightly, Heated) |
| pka | 1.20±0.30(Predicted) |
| form | Powder |
| color | Ochre |
| Merck | 14,10068 |
| BRN | 185954 |
| InChI | 1S/C10H7NO4/c12-7-3-1-2-5-8(13)4-6(10(14)15)11-9(5)7/h1-4,12H,(H,11,13)(H,14,15) |
| InChIKey | FBZONXHGGPHHIY-UHFFFAOYSA-N |
| SMILES | OC(=O)c1cc(O)c2cccc(O)c2n1 |
| CAS DataBase Reference | 59-00-7(CAS DataBase Reference) |
Description and Uses
Xanthurenic acid can be used as a substrate for the synthesis of:
- Silica-gel functionalized xanthurenic acid (4, 8-dihydroxyquinoline-2-carboxylic acid) as an adsorbent for metal ions.
- N, N′-bis-((8-hydroxy-7-quinolinyl)methyl)-1,10-diaza-18-crown-6 ethers as fluorescent sensors of magnesium in living cells via one-pot Mannich reaction.
- Poly-xanthurenic acid (poly-Xa) for biosensing applications.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| RTECS | UZ9275000 |
| HS Code | 29334900 |
| Storage Class | 11 - Combustible Solids |






