BD7604131
Dimethyl 5-iodoisophthalate , 98% , 51839-15-7
CAS NO.：51839-15-7
Empirical Formula: C10H9IO4
Molecular Weight: 320.08
MDL number: MFCD00079753
EINECS: 674-221-1
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB24.00 | In Stock |
|
| 1g | RMB39.20 | In Stock |
|
| 5g | RMB121.60 | In Stock |
|
| 10g | RMB235.20 | In Stock |
|
| 25g | RMB550.40 | In Stock |
|
| 100g | RMB2051.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 105 °C |
| Boiling point: | 160°C 1mm |
| Density | 1.708±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly, Heated) |
| form | Solid |
| color | Pale Beige |
| InChI | InChI=1S/C10H9IO4/c1-14-9(12)6-3-7(10(13)15-2)5-8(11)4-6/h3-5H,1-2H3 |
| InChIKey | DIAONVDUSXRXCE-UHFFFAOYSA-N |
| SMILES | C1(C(OC)=O)=CC(I)=CC(C(OC)=O)=C1 |
| CAS DataBase Reference | 51839-15-7(CAS DataBase Reference) |
Description and Uses
Dimethyl 5-Iodoisophthalate is used for succinimidyl 3-iodobenzoate (SIB) with DOTA as prosthetic group for multi-modal labeling enhancing tumor uptake of radiolabelled monoclonal antibodies (mAbs).
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36/37/39 |
| HazardClass | IRRITANT |
| HS Code | 29163990 |
