BD7615831
1,5-Dimethyl-1H-pyrazole-3-carboxylic acid , 98% , 5744-59-2
| Pack Size | Price | Stock | Quantity |
| 1g | RMB30.40 | In Stock |
|
| 5g | RMB75.20 | In Stock |
|
| 10g | RMB145.60 | In Stock |
|
| 25g | RMB355.20 | In Stock |
|
| 100g | RMB1396.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 170-176 °C |
| Boiling point: | 302.4±22.0 °C(Predicted) |
| Density | 1.28±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| pka | 4.12±0.10(Predicted) |
| form | Solid |
| color | White to Almost white |
| InChI | InChI=1S/C6H8N2O2/c1-4-3-5(6(9)10)7-8(4)2/h3H,1-2H3,(H,9,10) |
| InChIKey | PXRXGHUTKHXUGF-UHFFFAOYSA-N |
| SMILES | N1(C)C(C)=CC(C(O)=O)=N1 |
| CAS DataBase Reference | 5744-59-2(CAS DataBase Reference) |
Description and Uses
1,5-Dimethyl-1H-pyrazole-3-carboxylic acid is a biochemical reagent that can be used as a biological material or organic compound for life science related research.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 26-36/37/39-37/39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29331990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






