BD7619531
4-Vinylbenzaldehyde , 97% , 1791-26-0
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB190.40 | In Stock |
|
| 250mg | RMB320.00 | In Stock |
|
| 1g | RMB833.60 | In Stock |
|
| 5g | RMB2940.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 129-131 °C |
| Boiling point: | 92-93 °C(Press: 14 Torr) |
| Density | 1.036 g/cm3(Temp: 25 °C) |
| storage temp. | Inert atmosphere,Store in freezer, under -20°C |
| Appearance | Colorless to light yellow Liquid |
| InChI | InChI=1S/C9H8O/c1-2-8-3-5-9(7-10)6-4-8/h2-7H,1H2 |
| InChIKey | QBFNGLBSVFKILI-UHFFFAOYSA-N |
| SMILES | C(=O)C1=CC=C(C=C)C=C1 |
Description and Uses
4-Vinylbenzaldehyde is a mushroom tyrosinase inhibitor.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
