BD7639431
5-Amino-1-(4-fluorophenyl)-1H-pyrazole-4-carbonitrile , 97% , 51516-70-2
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB36.80 | In Stock |
|
| 1g | RMB128.80 | In Stock |
|
| 5g | RMB476.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 164-165°C |
| Boiling point: | 394.1±37.0 °C(Predicted) |
| Density | 1.36±0.1 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| pka | -0.92±0.10(Predicted) |
| form | solid |
| Appearance | Yellow to brown Solid |
| InChI | 1S/C10H7FN4/c11-8-1-3-9(4-2-8)15-10(13)7(5-12)6-14-15/h1-4,6H,13H2 |
| InChIKey | SZEJYPAPBGNEMH-UHFFFAOYSA-N |
| SMILES | Nc1c(cnn1-c2ccc(F)cc2)C#N |
| CAS DataBase Reference | 51516-70-2(CAS DataBase Reference) |
Description and Uses
5-Amino-1-(4-fluorophenyl)pyrazole-4-carbonitrile was used in the preparation of compounds that were shown to have anti-viral activity against TMV.
Safety
| Symbol(GHS) | ![]() ![]() GHS05, GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H318 |
| Precautionary statements | P280-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 20/21/22-41 |
| Safety Statements | 22-36/37/39-39-26 |
| RIDADR | 3439 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 2933199090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 |







