BD7652531
5-Bromo-3-iodo-1H-indazole , 98% , 459133-66-5
CAS NO.：459133-66-5
Empirical Formula: C7H4BrIN2
Molecular Weight: 322.93
MDL number: MFCD07781637
EINECS: 200-258-5
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB28.80 | In Stock |
|
| 1g | RMB38.40 | In Stock |
|
| 5g | RMB180.80 | In Stock |
|
| 10g | RMB349.60 | In Stock |
|
| 25g | RMB852.80 | In Stock |
|
| 100g | RMB2618.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 196 °C(Solv: ligroine (8032-32-4)) |
| Boiling point: | 413.1±25.0 °C(Predicted) |
| Density | 2.421±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| pka | 10.78±0.40(Predicted) |
| Appearance | Off-white to light yellow Solid |
| InChI | InChI=1S/C7H4BrIN2/c8-4-1-2-6-5(3-4)7(9)11-10-6/h1-3H,(H,10,11) |
| InChIKey | IBFAYUXCRDDBRD-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=C(Br)C=C2)C(I)=N1 |
Description and Uses
5-Bromo-3-iodo-1H-indazole is important chemical intermediate.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P260-P280-P301+P312-P302+P352-P304+P340-P361+P364 |
| RIDADR | UN2811 |
| HS Code | 2933998090 |
