BD7685431
5-Methyl-2-phenyloxazole-4-carboxylic acid , 97% , 18735-74-5
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB192.00 | In Stock |
|
| 1g | RMB476.00 | In Stock |
|
| 5g | RMB1704.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 182 °C |
| Boiling point: | 400.1±37.0 °C(Predicted) |
| Density | 1.273±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| form | solid |
| pka | 3.03±0.32(Predicted) |
| InChI | 1S/C11H9NO3/c1-7-9(11(13)14)12-10(15-7)8-5-3-2-4-6-8/h2-6H,1H3,(H,13,14) |
| InChIKey | YABCPNYCFFUVNM-UHFFFAOYSA-N |
| SMILES | Cc1oc(nc1C(O)=O)-c2ccccc2 |
| CAS DataBase Reference | 18735-74-5 |
Description and Uses
2-Phenyl-5-methyloxazole-4-carboxylic Acid is a building block used to prepare oxazole transthyretin amyloidogenesis inhibitors. It is also used to synthesize inhibitors of HldE kinase as Gram-negative antivirulence drugs.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H332-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| target organs | Respiratory system |
| WGK Germany | WGK 3 |
| Hazard Note | Harmful |
| HS Code | 2934999090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
