BD7690231
5-Nitro-3-pyrazolecarboxylic acid , 98% , 198348-89-9
CAS NO.:198348-89-9
Empirical Formula: C4H3N3O4
Molecular Weight: 157.08
MDL number: MFCD00192356
EINECS: 607-884-2
| Pack Size | Price | Stock | Quantity |
| 1g | RMB34.40 | In Stock |
|
| 5g | RMB153.60 | In Stock |
|
| 10g | RMB296.80 | In Stock |
|
| 25g | RMB721.60 | In Stock |
|
| 100g | RMB2836.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 188-190 °C(lit.) |
| Boiling point: | 509.6±35.0 °C(Predicted) |
| Density | 1.840±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| form | solid |
| pka | 3.22±0.10(Predicted) |
| color | Slightly yellow |
| InChI | InChI=1S/C4H3N3O4/c8-4(9)2-1-3(6-5-2)7(10)11/h1H,(H,5,6)(H,8,9) |
| InChIKey | HKYHBMLIEAMWRO-UHFFFAOYSA-N |
| SMILES | N1C([N+]([O-])=O)=CC(C(O)=O)=N1 |
| CAS DataBase Reference | 198348-89-9(CAS DataBase Reference) |
Description and Uses
5-Nitro-1H-pyrazole-3-carboxylic acid was investigated for potential therapeutic properties on ocular blood flow and retinal function recovery after reperfusion injury and ischemic insult.






