BD7696231
2-Bromo-6-methylaniline , 98% , 53848-17-2
| Pack Size | Price | Stock | Quantity |
| 1g | RMB36.80 | In Stock |
|
| 5g | RMB135.20 | In Stock |
|
| 10g | RMB252.80 | In Stock |
|
| 25g | RMB617.60 | In Stock |
|
| 100g | RMB2116.80 | In Stock |
|
| 500g | RMB10204.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 105-107 °C/205 mmHg (lit.) |
| Density | 1.4780 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 215 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| pka | 2.39±0.10(Predicted) |
| Appearance | Off-white to yellow Solid-Liquid Mixture |
| InChI | InChI=1S/C7H8BrN/c1-5-3-2-4-6(8)7(5)9/h2-4H,9H2,1H3 |
| InChIKey | LDUCMSVRKKDATH-UHFFFAOYSA-N |
| SMILES | C1(N)=C(C)C=CC=C1Br |
| CAS DataBase Reference | 53848-17-2(CAS DataBase Reference) |
Description and Uses
2-Bromo-6-methylaniline can be used as a reactant to synthesize:
- Alkyl substituted bromoindazole building blocks by Pd-catalyzed Suzuki coupling reaction with various vinyl boronic acids.
- Difluoropyridoindole via Pd-catalyzed intramolecular Heck reaction with difluoropiperidinone.
- 4-Methyl-N-phenyl-1H-benzo[d]imidazol-2-amine by one-pot Cu-catalyzed domino C-N cross-coupling reaction with iodobenzene and thiourea.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 2921430090 |
