BD7701531
2,6-Dimethoxypyrimidine-4-carboxylic acid , 97% , 59864-30-1
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB112.80 | In Stock |
|
| 1g | RMB294.40 | In Stock |
|
| 5g | RMB1048.00 | In Stock |
|
| 25g | RMB4024.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 162 |
| Boiling point: | 93-98°C/0.3mm |
| Density | 1.349±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| form | solid |
| pka | 2.85±0.30(Predicted) |
| color | White |
| InChI | InChI=1S/C7H8N2O4/c1-12-5-3-4(6(10)11)8-7(9-5)13-2/h3H,1-2H3,(H,10,11) |
| InChIKey | APCAETLUMQRTDK-UHFFFAOYSA-N |
| SMILES | C1(OC)=NC(OC)=CC(C(O)=O)=N1 |
| CAS DataBase Reference | 59864-30-1(CAS DataBase Reference) |
Description and Uses
2,4-Dimethoxypyrimidine-6-carboxylic Acid is a reactant or reagent in the synthetic preparation of racemic cylindrospermopsin.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xi |
| Hazard Note | Irritant |
| HS Code | 2933599590 |
