BD7704631
N-Cyanoacetylurethane , 95% , 6629-04-5
Synonym(s):
Ethyl cyanoacetylcarbamate
CAS NO.:6629-04-5
Empirical Formula: C6H8N2O3
Molecular Weight: 156.14
MDL number: MFCD00001937
EINECS: 229-615-4
| Pack Size | Price | Stock | Quantity |
| 1g | RMB24.00 | In Stock |
|
| 5g | RMB83.20 | In Stock |
|
| 10g | RMB155.20 | In Stock |
|
| 25g | RMB367.20 | In Stock |
|
| 100g | RMB1188.00 | In Stock |
|
| 500g | RMB5862.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 167-169 °C (lit.) |
| Boiling point: | 280.35°C (rough estimate) |
| Density | 1.197 |
| refractive index | 1.5010 (estimate) |
| storage temp. | 2-8°C |
| solubility | DMSO, Methanol |
| pka | 3.46±0.10(Predicted) |
| form | Solid |
| color | Pale Yellow |
| InChI | InChI=1S/C6H8N2O3/c1-2-11-6(10)8-5(9)3-4-7/h2-3H2,1H3,(H,8,9,10) |
| InChIKey | HSOGVWWWGVFXGF-UHFFFAOYSA-N |
| SMILES | C(OCC)(=O)NC(CC#N)=O |
Description and Uses
N-Cyanoacetylurethane is used in the synthesis of inhibitors targetting the PDZ domain of PICK1, which is a potential target for brain ischemia, pain and addiction illnesses. Also it is used in the synthesis of cathespin K inhibitors.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| RTECS | EZ3480000 |
| HazardClass | IRRITANT |
| HS Code | 2926907090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |




![ETHYL N-(2-CYANO-2-(2-[3-(TRIFLUOROMETHYL)PHENYL]HYDRAZONO)ACETYL)CARBAMATE](https://img.chemicalbook.com/StructureFile/ChemBookStructure2/GIF/CB8213785.gif)
