BD7723931
6-Acetylpicolinic acid , 97% , 122637-39-2
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB300.80 | In Stock |
|
| 250mg | RMB528.80 | In Stock |
|
| 1g | RMB1327.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 137℃ |
| Boiling point: | 360.4±27.0 °C(Predicted) |
| Density | 1.303±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| form | solid |
| pka | 0.65±0.50(Predicted) |
| Appearance | White to off-white Solid |
| Water Solubility | Slightly soluble in water. |
| InChI | 1S/C8H7NO3/c1-5(10)6-3-2-4-7(9-6)8(11)12/h2-4H,1H3,(H,11,12) |
| InChIKey | SMFINMWLJMPOES-UHFFFAOYSA-N |
| SMILES | O=C(C1=NC(C(C)=O)=CC=C1)O |
Description and Uses
Used as pharmaceutical intermediate.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| HazardClass | IRRITANT |
| HS Code | 2933399990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral |





