BD7745731
1-(5-Bromo-2-hydroxy-3-nitrophenyl)ethanone , 98% , 70978-54-0
Synonym(s):
3−Bromo-6−hydroxy-5−nitroacetophenone
| Pack Size | Price | Stock | Quantity |
| 1g | RMB24.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 129-132 °C(lit.) |
| Boiling point: | 272.9℃ |
| Density | 1.763 |
| Flash point: | 118.9℃ |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 6.47±0.38(Predicted) |
| form | powder to crystal |
| color | Light yellow to Yellow to Orange |
| InChI | 1S/C8H6BrNO4/c1-4(11)6-2-5(9)3-7(8(6)12)10(13)14/h2-3,12H,1H3 |
| InChIKey | CLNIBJASCGZXHH-UHFFFAOYSA-N |
| SMILES | CC(=O)c1cc(Br)cc(c1O)[N+]([O-])=O |
| CAS DataBase Reference | 70978-54-0(CAS DataBase Reference) |
Description and Uses
5'-Bromo-2'-hydroxy-3'-nitroacetophenone is used as a chemical reagent in the synthesis of amides and benzoxazoles directly using a sulfate catalyst and microwaves. 1-(5-Bromo-2-hydroxy-3-nitrophen yl)ethanone is used in studies involving HIV-1 integrase inhibitors.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 29145090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
