BD7754231
6-TAMRA , 98% , 91809-67-5
Synonym(s):
6-Carboxy-tetramethylrhodamine;6-TAMRA
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB240.80 | In Stock |
|
| 250mg | RMB480.00 | In Stock |
|
| 1g | RMB1262.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | NA |
| storage temp. | Keep in dark place,Inert atmosphere,2-8°C |
| solubility | DMSO: soluble |
| form | A solid |
| color | Light brown to black |
| Appearance | Purple solid |
| ex/em | 550/576 nm (MeOH/PBS) |
| ε(extinction coefficient) | 90000 L⋅mol−1⋅cm−1 |
| Φ(quantum yield) | 0.1 |
| InChI | InChI=1S/C25H22N2O5/c1-26(2)15-6-9-18-21(12-15)32-22-13-16(27(3)4)7-10-19(22)23(18)20-11-14(24(28)29)5-8-17(20)25(30)31/h5-13H,1-4H3,(H-,28,29,30,31) |
| InChIKey | COCMHKNAGZHBDZ-UHFFFAOYSA-N |
| SMILES | C(C1C=CC(C(=O)O)=CC=1C1=C2C=CC(N(C)C)=CC2=[O+]C2C=C(N(C)C)C=CC1=2)(=O)[O-] |
Description and Uses
6-Carboxytetramethylrhodamine is a fluorescent dye that has commonly been used for the covalent labeling of oligonucleotides for DNA analysis. It displays excitation/emission maxima of 543/572 nm, respectively. 6-Carboxytetramethylrhodamine has been used in various DNA-protein binding studies, DNA FRET experiments, and as a standard reporter or quencher dye in RT-PCR.
A long-wavelength dye
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| F | 8-10 |
| HS Code | 3204 90 00 |




