BD7763131
7-Deaza-2'-dA , 98% , 60129-59-1
CAS NO.:60129-59-1
Empirical Formula: C11H14N4O3
Molecular Weight: 250.25
MDL number: MFCD00672266
EINECS: 1592732-453-0
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB681.60 | In Stock |
|
| 250mg | RMB1025.60 | In Stock |
|
| 1g | RMB2561.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >217°C (dec.) |
| Boiling point: | 601℃ |
| Density | 1.75 |
| Flash point: | 318℃ |
| storage temp. | 2-8°C |
| solubility | DMSO (Slightly, Heated), Methanol (Slightly, Heated, Sonicated) |
| form | Solid |
| color | White to Pale Yellow |
| InChI | InChI=1/C11H14N4O3/c12-10-6-1-2-15(11(6)14-5-13-10)9-3-7(17)8(4-16)18-9/h1-2,5,7-9,16-17H,3-4H2,(H2,12,13,14)/t7-,8+,9+/s3 |
| InChIKey | NIJSNUNKSPLDTO-AGECWMLJNA-N |
| SMILES | N1(C=CC2C(N)=NC=NC1=2)[C@H]1C[C@H](O)[C@@H](CO)O1 |&1:10,12,14,r| |
Description and Uses
Deoxytubercidin was studied in mouse embryonic fibroblast and human colon cancer cell.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |







