BD7798331
2,4-Dichloroquinoline , 98% , 703-61-7
CAS NO.：703-61-7
Empirical Formula: C9H5Cl2N
Molecular Weight: 198.05
MDL number: MFCD00023939
EINECS: 640-568-2
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB34.40 | In Stock |
|
| 1g | RMB59.20 | In Stock |
|
| 5g | RMB160.00 | In Stock |
|
| 10g | RMB308.80 | In Stock |
|
| 25g | RMB750.40 | In Stock |
|
| 100g | RMB2926.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 52-54 |
| Boiling point: | 282°C(lit.) |
| Density | 1.4178 (rough estimate) |
| refractive index | 1.6610 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Chloroform, Methanol |
| form | Solid |
| pka | -1.10±0.50(Predicted) |
| color | White |
| λmax | 305nm(MeOH)(lit.) |
| InChI | InChI=1S/C9H5Cl2N/c10-7-5-9(11)12-8-4-2-1-3-6(7)8/h1-5H |
| InChIKey | QNBJYUUUYZVIJP-UHFFFAOYSA-N |
| SMILES | N1C2C(=CC=CC=2)C(Cl)=CC=1Cl |
| CAS DataBase Reference | 703-61-7(CAS DataBase Reference) |
Description and Uses
2,4-Dichloroquinoline is used in the synthesis of tRNA synthetase inhibitors with antibacterial activity against gram-positive bacteria. Also used in the preparation of arylquinolines displaying anthelmintic properties.
Safety
| Symbol(GHS) |    GHS05,GHS06,GHS07 |
| Signal word | Danger |
| Hazard statements | H301-H315-H318-H335-H319 |
| Precautionary statements | P261-P280-P301+P310-P305+P351+P338-P264-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Hazard Codes | Xi,T |
| Risk Statements | 36/37/38-41-37/38-25 |
| Safety Statements | 26-36-45-39 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| PackingGroup | Ⅲ |
| HS Code | 2933491090 |
