BD7812531
2-(1H-Benzo[d][1,2,3]triazol-1-yl)-2-(((benzyloxy)carbonyl)amino)acetic acid , 95% , 124676-19-3
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB71.20 | In Stock |
|
| 250mg | RMB111.20 | In Stock |
|
| 1g | RMB284.80 | In Stock |
|
| 5g | RMB1028.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 162-164℃ |
| Boiling point: | 596.4±50.0 °C(Predicted) |
| Density | 1.43 |
| storage temp. | 2-8°C |
| pka | 2.55±0.10(Predicted) |
| Appearance | White to off-white Solid |
| InChI | InChI=1S/C16H14N4O4/c21-15(22)14(20-13-9-5-4-8-12(13)18-19-20)17-16(23)24-10-11-6-2-1-3-7-11/h1-9,14H,10H2,(H,17,23)(H,21,22) |
| InChIKey | BNCGQJZQVLAXAB-UHFFFAOYSA-N |
| SMILES | N1(N=NC2C=CC=CC1=2)C(C(=O)O)NC(=O)OCC1=CC=CC=C1 |
Description and Uses
α-[[(Phenylmethoxy)carbonyl]amino]-1H-benzotriazole-1-acetic Acid is used in the synthesis of inhibitors of BET bromodomains. Also used in the synthesis of benzodiazepine-based SUMO-specific protein kinases.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H332-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| HS Code | 2933998090 |

![2-(1H-Benzo[d][1,2,3]triazol-1-yl)-2-(((benzyloxy)carbonyl)amino)acetic acid](https://img.chemicalbook.com/CAS/GIF/124676-19-3.gif)

![2-(1H-Benzo[d][1,2,3]triazol-1-yl)acetic acid](https://img.chemicalbook.com/CAS/GIF/4144-64-3.gif)


