BD7813331
(2R,3S)-Benzyl 6-oxo-2,3-diphenylmorpholine-4-carboxylate , 95% , 100516-54-9
Synonym(s):
Benzyl (2R,3S)-(−)-6-oxo-2,3-diphenyl-4-morpholinecarboxylate
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB157.60 | In Stock |
|
| 1g | RMB396.80 | In Stock |
|
| 5g | RMB1506.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 205-207 °C(lit.) |
| alpha | -66 º (c=5.5 in methylene chloride) |
| Boiling point: | 583.5±50.0 °C(Predicted) |
| Density | 1.242±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Dichloromethane (Slightly), DMSO (Slightly) |
| form | Solid |
| pka | -3.33±0.60(Predicted) |
| color | White |
| optical activity | [α]25/D 66°, c = 5.5 in methylene chloride |
| InChI | InChI=1S/C24H21NO4/c26-21-16-25(24(27)28-17-18-10-4-1-5-11-18)22(19-12-6-2-7-13-19)23(29-21)20-14-8-3-9-15-20/h1-15,22-23H,16-17H2/t22-,23+/m0/s1 |
| InChIKey | HECRUWTZAMPQOS-XZOQPEGZSA-N |
| SMILES | N1(C(OCC2=CC=CC=C2)=O)CC(=O)O[C@H](C2=CC=CC=C2)[C@@H]1C1=CC=CC=C1 |
Description and Uses
(2R,3S)-()-N-Z-6-Oxo-2,3-diphenylmorpholine can be used in the optimized large scale synthesis of L-m-tyrosine. Also used in the asymmetric synthesis of Fmoc-L-cyclopentylglycine.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| HS Code | 29349990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





