BD7834531
Boc-D-Glu(OtBu)-OH , 97% , 104719-63-3
Synonym(s):
Boc-D -glutamic acid 5-tert-butyl ester;Boc-D-Glu(OtBu)-OH;N-α-t.-Boc-D-glutamic acid γ-t.-butyl ester
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB20.00 | In Stock |
|
| 1g | RMB24.00 | In Stock |
|
| 5g | RMB84.00 | In Stock |
|
| 10g | RMB149.60 | In Stock |
|
| 25g | RMB361.60 | In Stock |
|
| 100g | RMB1292.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 449.8±40.0 °C(Predicted) |
| Density | 1.121 |
| storage temp. | Sealed in dry,2-8°C |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| form | Solid |
| pka | 3.82±0.10(Predicted) |
| Appearance | White to off-white Solid |
| optical activity | 13.073°(C=0.005g/mL, MEOH, 20°C, 589nm) |
| BRN | 3594191 |
| Major Application | peptide synthesis |
| InChI | 1S/C14H25NO6/c1-13(2,3)20-10(16)8-7-9(11(17)18)15-12(19)21-14(4,5)6/h9H,7-8H2,1-6H3,(H,15,19)(H,17,18)/t9-/m1/s1 |
| InChIKey | YGSRAYJBEREVRB-SECBINFHSA-N |
| SMILES | CC(C)(C)OC(=O)CC[C@@H](NC(=O)OC(C)(C)C)C(O)=O |
| CAS DataBase Reference | 104719-63-3(CAS DataBase Reference) |
Description and Uses
N-Boc-D-glutamic Acid 5-tert-Butyl Ester is used as a reactant in the synthesis of peptides.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| WGK Germany | 3 |
| HS Code | 2924 19 00 |
| Storage Class | 11 - Combustible Solids |







