BD7888531
                    Boc-Thr(Me)-OH , 96% , 48068-25-3
| Pack Size | Price | Stock | Quantity | 
| 1g | RMB25.60 | In Stock | 
                                                 | 
                                        
| 5g | RMB120.00 | In Stock | 
                                                 | 
                                        
| 10g | RMB203.20 | In Stock | 
                                                 | 
                                        
| 25g | RMB472.00 | In Stock | 
                                                 | 
                                        
| 100g | RMB1611.20 | In Stock | 
                                                 | 
                                        
| others | Enquire | 
Update time: 2022-07-08
                    PRODUCT Properties
| Boiling point: | 362.1±37.0 °C(Predicted) | 
                                    
| Density | 1.123±0.06 g/cm3(Predicted) | 
                                    
| storage temp. | 2-8°C | 
                                    
| pka | 3.50±0.10(Predicted) | 
                                    
| form | Solid | 
                                    
| color | White to off-white | 
                                    
| InChI | InChI=1S/C10H19NO5/c1-6(15-5)7(8(12)13)11-9(14)16-10(2,3)4/h6-7H,1-5H3,(H,11,14)(H,12,13)/t6-,7+/m1/s1 | 
                                    
| InChIKey | VWSUOKFUIPMDDX-RQJHMYQMSA-N | 
                                    
| SMILES | C(O)(=O)[C@H]([C@H](OC)C)NC(OC(C)(C)C)=O | 
                                    
Description and Uses
Boc-Thr(Me)-OH is a threonine derivative[1].
Safety
| Symbol(GHS) | ![]() GHS07  | 
                                    
| Signal word | Warning | 
| Hazard statements | H315-H319-H335 | 
| Precautionary statements | P233-P260-P261-P264-P271-P280-P302+P352-P304-P304+P340-P305+P351+P338-P312-P321-P332+P313-P337+P313-P340-P362-P403-P403+P233-P405-P501 | 
| HS Code | 2922500090 | 





![2,5-Dioxopyrrolidin-1-ylN-(((2-([1,1''-biphenyl]-4-yl)propan-2-yl)oxy)carbonyl)-O-(tert-butyl)-L-threoninate](https://img.chemicalbook.com/CAS/GIF/62020-53-5.gif)
