PRODUCT Properties
Melting point: | 47-49 °C (lit.) |
Boiling point: | 285 °C (lit.) |
Density | 1.0074 (rough estimate) |
refractive index | 1.5948 (estimate) |
Flash point: | >230 °F |
storage temp. | Sealed in dry,Room Temperature |
solubility | Soluble in acetone, benzene, ether. |
form | Solid |
color | Pale yellow |
InChI | InChI=1S/C14H14O/c1-11-3-7-13(8-4-11)15-14-9-5-12(2)6-10-14/h3-10H,1-2H3 |
InChIKey | YWYHGNUFMPSTTR-UHFFFAOYSA-N |
SMILES | O(C1=CC=C(C)C=C1)C1=CC=C(C)C=C1 |
CAS DataBase Reference | 1579-40-4(CAS DataBase Reference) |
NIST Chemistry Reference | 1-Methyl-4-(4-methylphenoxy)benzene(1579-40-4) |
EPA Substance Registry System | p-Tolyl ether (1579-40-4) |
Description and Uses
Di-p-tolyl ether is used to form conformationally chiral molecules in the solid state, while the chirality of 1,3-dimethyl-2-phenoxybenzene arises from the formation of supramolecular helices.
Safety
Symbol(GHS) | ![]() ![]() GHS07,GHS09 |
Signal word | Warning |
Hazard statements | H315-H319-H335-H410 |
Precautionary statements | P261-P264-P271-P273-P302+P352-P305+P351+P338 |
Hazard Codes | Xi,N |
Risk Statements | 36/37/38-50/53 |
Safety Statements | 26-36-61 |
RIDADR | UN 3077 9/PG 3 |
WGK Germany | 2 |
RTECS | DA6625000 |
TSCA | Yes |
HazardClass | 9 |
HS Code | 29093090 |