PRODUCT Properties
| Melting point: | 47-49 °C (lit.) |
| Boiling point: | 285 °C (lit.) |
| Density | 1.0074 (rough estimate) |
| refractive index | 1.5948 (estimate) |
| Flash point: | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Soluble in acetone, benzene, ether. |
| form | Solid |
| color | Pale yellow |
| InChI | InChI=1S/C14H14O/c1-11-3-7-13(8-4-11)15-14-9-5-12(2)6-10-14/h3-10H,1-2H3 |
| InChIKey | YWYHGNUFMPSTTR-UHFFFAOYSA-N |
| SMILES | O(C1=CC=C(C)C=C1)C1=CC=C(C)C=C1 |
| CAS DataBase Reference | 1579-40-4(CAS DataBase Reference) |
| NIST Chemistry Reference | 1-Methyl-4-(4-methylphenoxy)benzene(1579-40-4) |
| EPA Substance Registry System | p-Tolyl ether (1579-40-4) |
Description and Uses
Di-p-tolyl ether is used to form conformationally chiral molecules in the solid state, while the chirality of 1,3-dimethyl-2-phenoxybenzene arises from the formation of supramolecular helices.
Safety
| Symbol(GHS) |   GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335-H410 |
| Precautionary statements | P261-P264-P271-P273-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,N |
| Risk Statements | 36/37/38-50/53 |
| Safety Statements | 26-36-61 |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 2 |
| RTECS | DA6625000 |
| TSCA | Yes |
| HazardClass | 9 |
| HS Code | 29093090 |
