BD7912431
2-Hydroxyquinoline-4-carboxylic acid , 97% , 84906-81-0
CAS NO.：84906-81-0
Empirical Formula: C10H7NO3
Molecular Weight: 189.17
MDL number: MFCD00023942
EINECS: 628-092-3
| Pack Size | Price | Stock | Quantity |
| 1g | RMB24.00 | In Stock |
|
| 5g | RMB45.60 | In Stock |
|
| 10g | RMB77.60 | In Stock |
|
| 25g | RMB188.80 | In Stock |
|
| 100g | RMB742.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >300 °C |
| Boiling point: | 473.6±30.0 °C(Predicted) |
| Density | 1.480±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| form | solid |
| pka | 2.69±0.10(Predicted) |
| Appearance | Light green to green Solid |
| InChI | InChI=1S/C10H7NO3/c12-9-5-7(10(13)14)6-3-1-2-4-8(6)11-9/h1-5H,(H,11,12)(H,13,14) |
| InChIKey | MFSHNFBQNVGXJX-UHFFFAOYSA-N |
| SMILES | N1C2C(=CC=CC=2)C(C(O)=O)=CC=1O |
| CAS DataBase Reference | 84906-81-0(CAS DataBase Reference) |
Description and Uses
2-Hydroxyquinoline-4-carboxylic Acid is used in radiolysis of carboxyquinolines and chemiluminescent reaction of dihydroquinoline products with bases in presence of oxygen.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P280-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| WGK Germany | 3 |
