A6354430
7-Bromo-4-hydroxyquinoline , 95% , 82121-06-0
CAS NO.：82121-06-0
Empirical Formula: C9H6BrNO
Molecular Weight: 224.05
MDL number: MFCD06659037
EINECS: 804-508-0
| Pack Size | Price | Stock | Quantity |
| 1g | RMB253.60 | In Stock |
|
| 5g | RMB788.00 | In Stock |
|
| 25g | RMB2456.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 279-281 °C |
| Boiling point: | 370.7±22.0 °C(Predicted) |
| Density | 1.705±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | solid |
| pka | 3.83±0.40(Predicted) |
| color | Brown |
| InChI | InChI=1S/C9H6BrNO/c10-6-1-2-7-8(5-6)11-4-3-9(7)12/h1-5H,(H,11,12) |
| InChIKey | GGCBEWNXEGDQAP-UHFFFAOYSA-N |
| SMILES | N1C2C(=CC=C(Br)C=2)C(O)=CC=1 |
Description and Uses
7-Bromoquinolin-4-ol acts as a reagent in the synthesis of quinoline Schiff bases which are used pharmacologically for antibacterial activity.
Safety
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H318 |
| Precautionary statements | P280-P301+P312+P330-P305+P351+P338+P310 |
| Hazard Codes | Xn |
| Risk Statements | 22-41 |
| Safety Statements | 26-39 |
| WGK Germany | 3 |
| HS Code | 2933499090 |
