BD7916631
3-Methyl-8-quinolinesulphonyl chloride , 95% , 74863-82-4
CAS NO.：74863-82-4
Empirical Formula: C10H8ClNO2S
Molecular Weight: 241.69
MDL number: MFCD02683367
EINECS: 616-150-0
| Pack Size | Price | Stock | Quantity |
| 1g | RMB40.00 | In Stock |
|
| 5g | RMB152.00 | In Stock |
|
| 25g | RMB633.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 158-159°C |
| Boiling point: | 371.5±27.0 °C(Predicted) |
| Density | 1.424±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly), Methanol (Very Slightly) |
| form | Solid |
| pka | 0.82±0.28(Predicted) |
| color | White to Pale Brown |
| Stability: | Moisture Sensitive - Store Under Inert Atmosphere |
| InChI | InChI=1S/C10H8ClNO2S/c1-7-5-8-3-2-4-9(15(11,13)14)10(8)12-6-7/h2-6H,1H3 |
| InChIKey | XCMAYGDQKTWICK-UHFFFAOYSA-N |
| SMILES | N1C2C(=CC=CC=2S(Cl)(=O)=O)C=C(C)C=1 |
| CAS DataBase Reference | 74863-82-4(CAS DataBase Reference) |
Description and Uses
3-Methyl-8-quinolinesulfonyl Chloride (cas# 74863-82-4) is a compound useful in organic synthesis.
