BD7933731
Ethyl 3-oxocyclohexane-1-carboxylate , 96% , 33668-25-6
CAS NO.:33668-25-6
Empirical Formula: C9H14O3
Molecular Weight: 170.21
MDL number: MFCD00205583
EINECS: 251-626-8
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB177.60 | In Stock |
|
| 1g | RMB397.60 | In Stock |
|
| 5g | RMB1216.80 | In Stock |
|
| 10g | RMB1760.00 | In Stock |
|
| 25g | RMB3934.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 249℃ |
| Density | 1.083 |
| Flash point: | 104℃ |
| storage temp. | 2-8°C |
| Appearance | Colorless to light yellow Liquid |
| InChI | InChI=1S/C9H14O3/c1-2-12-9(11)7-4-3-5-8(10)6-7/h7H,2-6H2,1H3 |
| InChIKey | YLRVJPQVDQQBOX-UHFFFAOYSA-N |
| SMILES | C1(C(OCC)=O)CCCC(=O)C1 |
Description and Uses
Ethyl Cyclohexanone-β-carboxylate is an intermediate used to prepare carbazole-carboxamides with selective JAK2 inhibitory activities.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 41 |
| Safety Statements | 26-39 |
| WGK Germany | WGK 3 |
| Hazard Note | Irritant |
| HS Code | 2918199890 |
| Storage Class | 13 - Non Combustible Solids |
| Hazard Classifications | Eye Dam. 1 |




![Diethyl 2,5-dioxobicyclo[2.2.2]octane-1,4-dicarboxylate](https://img.chemicalbook.com/CAS/GIF/843-59-4.gif)
