BD7939031
Dimethyl 4-nitrophthalate , 97% , 610-22-0
CAS NO.：610-22-0
Empirical Formula: C10H9NO6
Molecular Weight: 239.18
MDL number: MFCD00017191
EINECS: 210-212-7
| Pack Size | Price | Stock | Quantity |
| 10g | RMB42.40 | In Stock |
|
| 25g | RMB91.20 | In Stock |
|
| 100g | RMB336.00 | In Stock |
|
| 500g | RMB963.20 | In Stock |
|
| 1000g | RMB1544.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 64-66 °C (lit.) |
| Boiling point: | 192-195 °C/25 mmHg (lit.) |
| Density | 1.4504 (rough estimate) |
| refractive index | 1.5310 (estimate) |
| Flash point: | 192-195°C/25mm |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Ethyl Acetate (Sparingly) |
| form | Solid |
| color | White to Off-White |
| BRN | 1886234 |
| InChI | 1S/C10H9NO6/c1-16-9(12)7-4-3-6(11(14)15)5-8(7)10(13)17-2/h3-5H,1-2H3 |
| InChIKey | XWBDWELWBUWSNI-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(cc1C(=O)OC)[N+]([O-])=O |
| CAS DataBase Reference | 610-22-0(CAS DataBase Reference) |
| NIST Chemistry Reference | 4-Nitro phthalic acid, dimethyl ester(610-22-0) |
| EPA Substance Registry System | 1,2-Benzenedicarboxylic acid, 4-nitro-, dimethyl ester (610-22-0) |
Description and Uses
1,2-Dimethyl 4-nitrophthalate is a key intermediate for the synthesis of N-hydroxyphthalimide.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P280-P305+P351+P338 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29173990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
