BD7954031
Fludioxonil , 98% , 131341-86-1
CAS NO.:131341-86-1
Empirical Formula: C12H6F2N2O2
Molecular Weight: 248.18
MDL number: MFCD01631158
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB60.00 | In Stock |
|
| 1g | RMB155.20 | In Stock |
|
| 5g | RMB672.80 | In Stock |
|
| 10g | RMB1213.60 | In Stock |
|
| 25g | RMB2228.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 199.4° |
| Boiling point: | 420.4±45.0 °C(Predicted) |
| Density | 1.55±0.1 g/cm3(Predicted) |
| vapor pressure | 3.9 x 10-7 Pa (25 °C) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | DMSO: Slightly Soluble,Methanol: Slightly Soluble |
| Water Solubility | 1.8 mg l-1 in water at 25 °C |
| pka | 14.10±0.50(Predicted) |
| form | Solid |
| color | White to off-white |
| BRN | 8393936 |
| Henry's Law Constant | 1.9×104 mol/(m3Pa) at 25℃, Duchowicz et al. (2020) |
| Major Application | agriculture environmental |
| InChI | InChI=1S/C12H6F2N2O2/c13-12(14)17-10-3-1-2-8(11(10)18-12)9-6-16-5-7(9)4-15/h1-3,5-6,16H |
| InChIKey | MUJOIMFVNIBMKC-UHFFFAOYSA-N |
| SMILES | N1C=C(C2=C3C(=CC=C2)OC(F)(F)O3)C(C#N)=C1 |
| EPA Substance Registry System | Fludioxonil (131341-86-1) |
Description and Uses
Fludioxonil is a nonsystemic phenylpyrrole fungicide structurally related to pyrrolnitrin.
Safety
| Symbol(GHS) | ![]() GHS09 |
| Signal word | Warning |
| Hazard statements | H410 |
| Precautionary statements | P273-P391-P501 |
| PPE | Eyeshields, Gloves |
| Hazard Codes | N |
| Risk Statements | 50/53 |
| Safety Statements | 60-61 |
| RIDADR | 3077 |
| WGK Germany | 3 |
| RTECS | UX9347525 |
| HazardClass | 9 |
| PackingGroup | III |
| HS Code | 29349990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 |
| Hazardous Substances Data | 131341-86-1(Hazardous Substances Data) |
| Toxicity | LD50 in rats (mg/kg): >2000 orally; >2000 dermally; LC50 (4 hr) in rats: >2600 mg/m3 (Gehmann) |



