BD7964331
Fmoc-Tyr(tBu)-OPfp , 95+% , 86060-93-7
| Pack Size | Price | Stock | Quantity |
| 25g | RMB1747.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 61-64℃ |
| Boiling point: | 713.3±60.0 °C(Predicted) |
| Density | 1.334±0.06 g/cm3(Predicted) |
| storage temp. | Store at -15°C to -25°C. |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| pka | 10.13±0.46(Predicted) |
| form | Powder |
| color | White |
| BRN | 4223194 |
| Major Application | peptide synthesis |
| InChIKey | ADOSTZDWXCEVJP-VWLOTQADSA-N |
| SMILES | CC(C)(C)Oc1ccc(C[C@H](NC(=O)OCC2c3ccccc3-c4ccccc24)C(=O)Oc5c(F)c(F)c(F)c(F)c5F)cc1 |
Description and Uses
peptide synthesis
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315 |
| Precautionary statements | P264-P280-P302+P352-P332+P313-P362+P364 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HS Code | 29242990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Skin Irrit. 2 |
