BD7992831
1-Boc-4-Aminopiperidine-4-carboxylic acid , 97% , 183673-71-4
Synonym(s):
4-Amino-1-(tert-butoxycarbonyl)piperidine-4-carboxylic acid;4-Amino-1-Boc-piperidine-4-carboxylic acid
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB36.00 | In Stock |
|
| 1g | RMB80.00 | In Stock |
|
| 5g | RMB308.00 | In Stock |
|
| 10g | RMB590.40 | In Stock |
|
| 25g | RMB1366.40 | In Stock |
|
| 100g | RMB4506.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 290°C |
| Boiling point: | 387.21°C (rough estimate) |
| Density | 1.1583 (rough estimate) |
| refractive index | 1.4620 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Methanol |
| pka | 2.15±0.20(Predicted) |
| form | Solid |
| color | White to Off-White |
| BRN | 7588844 |
| InChI | InChI=1S/C11H20N2O4/c1-10(2,3)17-9(16)13-6-4-11(12,5-7-13)8(14)15/h4-7,12H2,1-3H3,(H,14,15) |
| InChIKey | YNHLVALLAURVJF-UHFFFAOYSA-N |
| SMILES | N1(C(OC(C)(C)C)=O)CCC(N)(C(O)=O)CC1 |
| CAS DataBase Reference | 183673-71-4(CAS DataBase Reference) |
Description and Uses
Cyclic α,α-disubstituted amino acid for the preparation of water-soluble highly helical peptides.
Safety
| Symbol(GHS) |  GHS08 |
| Signal word | Danger |
| Hazard statements | H360-H340-H351 |
| Precautionary statements | P501-P202-P201-P280-P308+P313-P405 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 37/39-26-24/25 |
| WGK Germany | 3 |
| HS Code | 29333990 |
