BD8022731
Methyl 2-(2-bromophenyl)acetate , 98% , 57486-69-8
| Pack Size | Price | Stock | Quantity |
| 1g | RMB24.00 | In Stock |
|
| 5g | RMB61.60 | In Stock |
|
| 10g | RMB109.60 | In Stock |
|
| 25g | RMB214.40 | In Stock |
|
| 100g | RMB684.80 | In Stock |
|
| 500g | RMB2964.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 264℃ |
| Density | 1.445 |
| Flash point: | 114℃ |
| storage temp. | Keep in dark place,Inert atmosphere,2-8°C |
| form | liquid |
| color | Pale yellow |
| InChI | InChI=1S/C9H9BrO2/c1-12-9(11)6-7-4-2-3-5-8(7)10/h2-5H,6H2,1H3 |
| InChIKey | AMVCFIFDMKEIRE-UHFFFAOYSA-N |
| SMILES | C1(CC(OC)=O)=CC=CC=C1Br |
Description and Uses
Methyl 2-(2-bromophenyl)acetate is a reagent in the synthesis of 2,3,3a,12b-Tetradehydro Asenapine (T291630). 2,3,3a,12b-Tetradehydro Asenapine is a degredation product of Asenapine (A788000), a combined serotonin (5HT2) and dopamine (D2) receptor antagonist; structurally related to Mianserin. Antipsychotic.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P271-P280 |
| Hazard Codes | Xi |
| Hazard Note | Irritant/Keep Cold |
| HS Code | 2916399090 |
